cas: 702640-51-5 — see every product listed under this CAS number, including other names
3-Bromo-6-chloro-2-fluorobenzoic acid, 98% (CAS 702640-51-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622537-1G |
| cas | 702640-51-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1039.24 Pln | |
| Fluorochem | 10g | 1861.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-6-chloro-2-fluorobenzoic acid (CAS 702640-51-5) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 3-bromo-6-chloro-2-fluorobenzoic acid. InChIKey: RMFKXLDHDDWWGR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 3-bromo-6-chloro-2-fluorobenzoic acid |
| InChIKey | RMFKXLDHDDWWGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C(=O)O)F)Br |
Computed by PubChem (NCBI)