3-Bromophenanthrene, 98% HPLC
cas: 715-50-4 — see every product listed under this CAS number, including other names
3-Bromophenanthrene, 98% HPLC (CAS 715-50-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A773252-250mg |
| cas | 715-50-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1032.31 Pln | |
| Ambeed | 25g | 3429.75 Pln | |
| Ambeed | 100g | 10822.31 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 1025.22 Pln | |
| BLDpharm | 25g | 3690.95 Pln | |
| BLDpharm | 100g | 11665.92 Pln |
properties
| purity | 98% HPLC |
|---|---|
| delivery time | 1-2 weeks |
3-bromophenanthrene (CAS 715-50-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 3-bromophenanthrene. InChIKey: BNGNNFQSUWVWCW-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-bromophenanthrene |
| InChIKey | BNGNNFQSUWVWCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)