3-Fluoro-4-nitrobenzene-1-sulfonyl chloride, 95%
cas: 86156-93-6 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrobenzene-1-sulfonyl chloride, 95% (CAS 86156-93-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A889337-250mg |
| cas | 86156-93-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 370.38 Pln | |
| Ambeed | 10g | 654.06 Pln | |
| Ambeed | 25g | 1338.25 Pln | |
| Ambeed | 100g | 4514.44 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 397.66 Pln | |
| BLDpharm | 10g | 697.56 Pln | |
| BLDpharm | 25g | 1441.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-fluoro-4-nitrobenzenesulfonyl chloride (CAS 86156-93-6) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 3-fluoro-4-nitrobenzenesulfonyl chloride. InChIKey: AAWFUSFNPBRQDE-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 3-fluoro-4-nitrobenzenesulfonyl chloride |
| InChIKey | AAWFUSFNPBRQDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)