CAS 603122-41-4 appears in our catalog under these names: 3–Methoxy–4–methoxycarbonylphenylboronic acid, 3-Methoxy-4-methoxycarbonylphenylboronic acid, 96%, 3-Methoxy-4-methoxycarbonylphenylboronic acid, 95%. Offered by: GLPBio, AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg, 10g.
(3-methoxy-4-methoxycarbonylphenyl)boronic acid (CAS 603122-41-4) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (3-methoxy-4-methoxycarbonylphenyl)boronic acid. InChIKey: YCXPWNGIPLGCOJ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (3-methoxy-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | YCXPWNGIPLGCOJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OC)OC)(O)O |
Computed by PubChem (NCBI)