cas: 126318-27-2 — see every product listed under this CAS number, including other names
3-Nitrobenzofuran-5-ol 97% (CAS 126318-27-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156666-100mg |
| cas | 126318-27-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1232.56 Pln | |
| Ambeed | 10g | 2300.56 Pln | |
| Ambeed | 25g | 5365.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A156666 |
3-nitro-1-benzofuran-5-ol (CAS 126318-27-2) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 3-nitro-1-benzofuran-5-ol. InChIKey: ZQPBTBWGCWHIGU-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 3-nitro-1-benzofuran-5-ol |
| InChIKey | ZQPBTBWGCWHIGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)