3-Phenethylphenol, 95%
cas: 33675-75-1 — see every product listed under this CAS number, including other names
3-Phenethylphenol, 95% (CAS 33675-75-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A612269-100mg |
| cas | 33675-75-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1076.81 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 436.54 Pln | |
| BLDpharm | 1g | 1152.95 Pln | |
| Fluorochem | 100mg | 310.32 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 1106.92 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(2-phenylethyl)phenol (CAS 33675-75-1) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 3-(2-phenylethyl)phenol. InChIKey: AIHZDRMFOVBNAV-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 3-(2-phenylethyl)phenol |
| InChIKey | AIHZDRMFOVBNAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)