CAS 100444-43-7 appears in our catalog under these names: 2,6-Dimethylbiphenyl-4-ol, 95%, 2,6-Dimethyl-[1,1'-biphenyl]-4-ol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
3,5-dimethyl-4-phenylphenol (CAS 100444-43-7) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 3,5-dimethyl-4-phenylphenol. InChIKey: DYOXPYDCDWDMRR-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 3,5-dimethyl-4-phenylphenol |
| InChIKey | DYOXPYDCDWDMRR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=CC=C2)C)O |
Computed by PubChem (NCBI)