4,5-Dichloro-2-fluorobenzoic Acid, 98%
cas: 289039-49-2 — see every product listed under this CAS number, including other names
4,5-Dichloro-2-fluorobenzoic Acid, 98% (CAS 289039-49-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113X23-250mg |
| cas | 289039-49-2 |
| size | 250mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 10g | 424.87 Pln | |
| Fluorochem | 25g | 961.14 Pln | |
| Fluorochem | 100g | 3616.45 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,5-dichloro-2-fluorobenzoic acid (CAS 289039-49-2) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 4,5-dichloro-2-fluorobenzoic acid. InChIKey: XFOJZPTYJMXNKK-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 4,5-dichloro-2-fluorobenzoic acid |
| InChIKey | XFOJZPTYJMXNKK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)