cas: 2148-55-2 — see every product listed under this CAS number, including other names
4,5-Dichloroquinazoline, 97% (CAS 2148-55-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 2.5g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-8499-5g |
| cas | 2148-55-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 250mg | 239.26 Pln | |
| AmBeed | 1g | 375.97 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 2.5g | 497.76 Pln | |
| Fluorochem | 5g | 825.77 Pln | |
| Fluorochem | 10g | 1362.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4,5-dichloroquinazoline (CAS 2148-55-2) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,5-dichloroquinazoline. InChIKey: PCCZEWAQRDIOKD-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,5-dichloroquinazoline |
| InChIKey | PCCZEWAQRDIOKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)