cas: 102714-71-6 — see every product listed under this CAS number, including other names
4,5-Dimethoxy-2-nitrobenzonitrile 98% (CAS 102714-71-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109287-1g |
| cas | 102714-71-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 871.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A109287 |
4,5-dimethoxy-2-nitrobenzonitrile (CAS 102714-71-6) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 4,5-dimethoxy-2-nitrobenzonitrile. InChIKey: NQSQQGDTYKGCOT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 4,5-dimethoxy-2-nitrobenzonitrile |
| InChIKey | NQSQQGDTYKGCOT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C#N)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)