cas: 102714-71-6 — see every product listed under this CAS number, including other names
4,5-Dimethoxy-2-nitrobenzonitrile (CAS 102714-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013146-250MG |
| cas | 102714-71-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 830.98 Pln | |
| Fluorochem | 100g | 2424.16 Pln |
| delivery time | 2-3 weeks |
|---|
4,5-dimethoxy-2-nitrobenzonitrile (CAS 102714-71-6) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 4,5-dimethoxy-2-nitrobenzonitrile. InChIKey: NQSQQGDTYKGCOT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 4,5-dimethoxy-2-nitrobenzonitrile |
| InChIKey | NQSQQGDTYKGCOT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C#N)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)