cas: 7253-22-7 — see every product listed under this CAS number, including other names
4,6-Dichloroquinazoline 98% (CAS 7253-22-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A611207-250mg |
| cas | 7253-22-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A611207 |
4,6-dichloroquinazoline (CAS 7253-22-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,6-dichloroquinazoline. InChIKey: JEBCOVKUVLFOGR-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,6-dichloroquinazoline |
| InChIKey | JEBCOVKUVLFOGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)