4,8-Dichloroquinazoline, 95%
cas: 7148-34-7 — see every product listed under this CAS number, including other names
4,8-Dichloroquinazoline, 95% (CAS 7148-34-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076932-1G |
| cas | 7148-34-7 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 10g | 1315.18 Pln | |
| Fluorochem | 25g | 3142.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4,8-dichloroquinazoline (CAS 7148-34-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,8-dichloroquinazoline. InChIKey: LGRUYTZVYJCUTH-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,8-dichloroquinazoline |
| InChIKey | LGRUYTZVYJCUTH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=CN=C2Cl |
Computed by PubChem (NCBI)