cas: 151982-51-3 — see every product listed under this CAS number, including other names
4-Bromo-2-fluorobenzoyl chloride 98% (CAS 151982-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170860-1g |
| cas | 151982-51-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 648.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170860 |
4-bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-fluorobenzoyl chloride. InChIKey: PCFIABOQFAFDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzoyl chloride |
| InChIKey | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
Computed by PubChem (NCBI)