cas: 151982-51-3 — see every product listed under this CAS number, including other names
4-Bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F062707-250MG |
| cas | 151982-51-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 25g | 456.11 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-fluorobenzoyl chloride. InChIKey: PCFIABOQFAFDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzoyl chloride |
| InChIKey | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
Computed by PubChem (NCBI)