cas: 22479-78-3 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)phenol, 95%, 95% (CAS 22479-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CBT9-100mg |
| cas | 22479-78-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 500mg | 1096.40 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-nitrophenoxy)phenol (CAS 22479-78-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 4-(4-nitrophenoxy)phenol. InChIKey: DCCDSAOUQRQDEL-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)phenol |
| InChIKey | DCCDSAOUQRQDEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)