cas: 42403-77-0 — see every product listed under this CAS number, including other names
4-(ALLYLOXY)BENZOPHENONE, 98% (CAS 42403-77-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F842408-1G |
| cas | 42403-77-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 3267.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Phenyl-(4-prop-2-enoxyphenyl)methanone (CAS 42403-77-0) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: phenyl-(4-prop-2-enoxyphenyl)methanone. InChIKey: VRWGRLFEHAONPN-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | phenyl-(4-prop-2-enoxyphenyl)methanone |
| InChIKey | VRWGRLFEHAONPN-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)