cas: 42403-77-0 — see every product listed under this CAS number, including other names
4-(Allyloxy)benzophenone, >97.0%(GC) (CAS 42403-77-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A3242-1G |
| cas | 42403-77-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 354.37 Pln | |
| TCI | 5g | 1096.88 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
Phenyl-(4-prop-2-enoxyphenyl)methanone (CAS 42403-77-0) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: phenyl-(4-prop-2-enoxyphenyl)methanone. InChIKey: VRWGRLFEHAONPN-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | phenyl-(4-prop-2-enoxyphenyl)methanone |
| InChIKey | VRWGRLFEHAONPN-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)