cas: 1539-06-6 — see every product listed under this CAS number, including other names
4-Acetamido-3-nitro benzoic acid, 98% (CAS 1539-06-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047879-1G |
| cas | 1539-06-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 565.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-acetamido-3-nitrobenzoic acid (CAS 1539-06-6) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 4-acetamido-3-nitrobenzoic acid. InChIKey: BRQIMWBIZLRLSV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 4-acetamido-3-nitrobenzoic acid |
| InChIKey | BRQIMWBIZLRLSV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)