CAS 138569-08-1 is the registry number for Methyl 4–carbamoyl–3–nitrobenzoate. Offered by: GLPBio. Available pack sizes: 100mg.
Methyl 4-carbamoyl-3-nitrobenzoate (CAS 138569-08-1) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: methyl 4-carbamoyl-3-nitrobenzoate. InChIKey: UFAWJRHHKFCGMK-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | methyl 4-carbamoyl-3-nitrobenzoate |
| InChIKey | UFAWJRHHKFCGMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)