cas: 2623-33-8 — see every product listed under this CAS number, including other names
4-Acetamidophenyl acetate, 98%, 98% (CAS 2623-33-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SDM-1g |
| cas | 2623-33-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 208.40 Pln | |
| Chemat | 25g | 338.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-acetamidophenyl) acetate (CAS 2623-33-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (4-acetamidophenyl) acetate. InChIKey: UJAOSPFULOFZRR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (4-acetamidophenyl) acetate |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)