CAS 1623-93-4 appears in our catalog under these names: Biphenyl–4–sulfonyl chloride, 4-Biphenylsulfonyl chloride, 97%, BIPHENYL-4-SULFONYL CHLORIDE, 4-Biphenylsulfonyl chloride, 99.59%, 4-Biphenylsulfonyl chloride, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich, MedChemExpress, Fluorochem. Available pack sizes: 25mg, 5g, 25g, 50 g, 25 g, 100 g, 1g, 10g.
4-phenylbenzenesulfonyl chloride (CAS 1623-93-4) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 4-phenylbenzenesulfonyl chloride. InChIKey: ALBQXDHCMLLQMB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 4-phenylbenzenesulfonyl chloride |
| InChIKey | ALBQXDHCMLLQMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)