4-Borono-3,5-difluorobenzoic acid, 98%
cas: 1031857-98-3 — see every product listed under this CAS number, including other names
4-Borono-3,5-difluorobenzoic acid, 98% (CAS 1031857-98-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F210480-100MG |
| cas | 1031857-98-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 305.12 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 2694.90 Pln | |
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 2612.06 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 669.20 Pln | |
| Chemat | 5g | 3074.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-borono-3,5-difluorobenzoic acid (CAS 1031857-98-3) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 4-borono-3,5-difluorobenzoic acid. InChIKey: QJZJINMQKWVLJB-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 4-borono-3,5-difluorobenzoic acid |
| InChIKey | QJZJINMQKWVLJB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)