cas: 351003-51-5 — see every product listed under this CAS number, including other names
4-Bromo-3-fluorobenzenesulfonyl chloride, 97% (CAS 351003-51-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013079-1G |
| cas | 351003-51-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 1153.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-3-fluorobenzenesulfonyl chloride (CAS 351003-51-5) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 4-bromo-3-fluorobenzenesulfonyl chloride. InChIKey: IZCXVIACMHTZNA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 4-bromo-3-fluorobenzenesulfonyl chloride |
| InChIKey | IZCXVIACMHTZNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)F)Br |
Computed by PubChem (NCBI)