CAS 76561-16-5 appears in our catalog under these names: 7-Bromo-1H-Benzo[d][1,3]Oxazine-2,4-Dione, 95%, 95%, 4-Bromoisatoic anhydride, 95%, 4-Bromoisatoic anhydride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 100mg.
7-bromo-1H-3,1-benzoxazine-2,4-dione (CAS 76561-16-5) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 7-bromo-1H-3,1-benzoxazine-2,4-dione. InChIKey: PDGHWWQDMPEMKS-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 7-bromo-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | PDGHWWQDMPEMKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)OC2=O |
Computed by PubChem (NCBI)