CAS 77603-45-3 appears in our catalog under these names: 5–Bromo–1H–benzo(d)(1,3)oxazine–2,4–dione, 6-Bromoisatoic anhydride, 5-Bromo-1H-benzo[d][1,3]oxazine-2,4-dione 95%, 2H-3,1-Benzoxazine-2,4(1H)-dione, 5-bromo-, 95%, 95%, 5-Bromo-1H-benzo[d][1,3]oxazine-2,4-dione, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 250mg.
5-bromo-1H-3,1-benzoxazine-2,4-dione (CAS 77603-45-3) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 5-bromo-1H-3,1-benzoxazine-2,4-dione. InChIKey: YELXVMUMHRDCKE-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 5-bromo-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | YELXVMUMHRDCKE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)