Products 944907-30-6

CAS 944907-30-6 is the registry number for 6-Bromobenzo(d)oxazole-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g, 1g.

6-bromo-1,3-benzoxazole-2-carboxylic acid (CAS 944907-30-6) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 6-bromo-1,3-benzoxazole-2-carboxylic acid. InChIKey: CIMXFTLLAUVPOK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrNO3
Molecular weight242.03 g/mol
IUPAC name6-bromo-1,3-benzoxazole-2-carboxylic acid
InChIKeyCIMXFTLLAUVPOK-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)OC(=N2)C(=O)O

Computed by PubChem (NCBI)