Products 944898-52-6

CAS 944898-52-6 is the registry number for 5-Bromobenzo[d]oxazole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-1,3-benzoxazole-2-carboxylic acid (CAS 944898-52-6) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 5-bromo-1,3-benzoxazole-2-carboxylic acid. InChIKey: AJRDRXNMYCNFOW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrNO3
Molecular weight242.03 g/mol
IUPAC name5-bromo-1,3-benzoxazole-2-carboxylic acid
InChIKeyAJRDRXNMYCNFOW-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)N=C(O2)C(=O)O

Computed by PubChem (NCBI)