Products 331646-98-1
CAS 331646-98-1 appears in our catalog under these names: 3-Bromoisatoic anhydride, 98%, 8-Bromo-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98%, 8-Bromo-1h-benzo[d][1,3]oxazine-2,4-dione, 98%, 8–Bromo–1H–benzo(d)(1，3)oxazine–2，4–dione, 3-Bromoisatoic anhydride 97%. Offered by: Fluorochem, Chemat, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
8-bromo-1H-3,1-benzoxazine-2,4-dione (CAS 331646-98-1) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 8-bromo-1H-3,1-benzoxazine-2,4-dione. InChIKey: YRJWMRDVBYWGKK-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 8-bromo-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | YRJWMRDVBYWGKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=O)OC2=O |
Computed by PubChem (NCBI)