Products 1805487-23-3

CAS 1805487-23-3 is the registry number for 2-Bromo-5-cyano-3-hydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-5-cyano-3-hydroxybenzoic acid (CAS 1805487-23-3) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 2-bromo-5-cyano-3-hydroxybenzoic acid. InChIKey: UILJVJYFZQGAPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrNO3
Molecular weight242.03 g/mol
IUPAC name2-bromo-5-cyano-3-hydroxybenzoic acid
InChIKeyUILJVJYFZQGAPZ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)Br)O)C#N

Computed by PubChem (NCBI)