Products 1780391-64-1
CAS 1780391-64-1 is the registry number for 7-Bromofuro[3,2-c]pyridine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromofuro[3,2-c]pyridine-2-carboxylic acid (CAS 1780391-64-1) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 7-bromofuro[3,2-c]pyridine-2-carboxylic acid. InChIKey: OJUXYJFHQJVTLY-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 7-bromofuro[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | OJUXYJFHQJVTLY-UHFFFAOYSA-N |
| SMILES | C1=C(OC2=C(C=NC=C21)Br)C(=O)O |
Computed by PubChem (NCBI)