CAS 1123169-28-7 appears in our catalog under these names: 5-Bromobenzo[d]isoxazole-3-carboxylic acid, 95%, 5-Bromobenzo(d)isoxazole-3-carboxylic acid, 97+%, 5-bromo-1,2-benzoxazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 25mg, 50mg, 0,5g.
5-bromo-1,2-benzoxazole-3-carboxylic acid (CAS 1123169-28-7) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 5-bromo-1,2-benzoxazole-3-carboxylic acid. InChIKey: KOYBGMVZWNFEIM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 5-bromo-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | KOYBGMVZWNFEIM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NO2)C(=O)O |
Computed by PubChem (NCBI)