Products 4692-98-2
CAS 4692-98-2 appears in our catalog under these names: 5–Bromoisatoic anhydride, 5-Bromoisatoic anhydride, 5-Bromoisatoic Anhydride, >98.0%(HPLC)(T), 5-Bromoisatoic anhydride, 97%, 97%, 5-Bromoisatoic anhydride, 90%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 5g, 50g, 100g, 250g, 1g, 500g.
6-bromo-1H-3,1-benzoxazine-2,4-dione (CAS 4692-98-2) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 6-bromo-1H-3,1-benzoxazine-2,4-dione. InChIKey: DXSMYDSFWCOSFM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 6-bromo-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | DXSMYDSFWCOSFM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
5-Bromoisatoic anhydride, 6-bromo-1H-3,1-benzoxazine-2,4-dione, 6-bromo-1h-benzo[d][1,3]oxazine-2,4-dione, 6-bromo-2H-3,1-benzoxazine-2,4(1H)-dione, 5-Bromoisatoicanhydride, 2H-3,1-benzoxazine-2,4(1H)-dione, 6-bromo-, 6-Bromo-1,2-dihydro-4H-3,1-benzoxazine-2,4-dione, 6-bromo-2,4-dihydro-1H-3,1-benzoxazine-2,4-dione, 6-bromo-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 5-bromo-isatoic anhydride