CAS 24088-82-2 appears in our catalog under these names: 6-Bromo-2h-benzo[e][1,3]oxazine-2,4(3h)-dione, 95%, 6–Bromo–2H–1,3–Benzoxazine–2,4(3H)–Dione, 6-Bromo-2h-1,3-benzoxazine-2,4(3h)-dione, 6-Bromo-2H-benzo[e][1,3]oxazine-2,4(3H)-dione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg.
6-bromo-1,3-benzoxazine-2,4-dione (CAS 24088-82-2) is a chemical compound with the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. IUPAC name: 6-bromo-1,3-benzoxazine-2,4-dione. InChIKey: QFUCRLHRLJFXBG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 6-bromo-1,3-benzoxazine-2,4-dione |
| InChIKey | QFUCRLHRLJFXBG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)NC(=O)O2 |
Computed by PubChem (NCBI)