cas: 3964-04-3 — see every product listed under this CAS number, including other names
4-Bromoquinoline, 97%, 97% (CAS 3964-04-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144YQ-1g |
| cas | 3964-04-3 |
| size | 1g |
| availability | 442.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 357.20 Pln | |
| Chemat | 100g | 654.80 Pln | |
| Chemat | 250g | 1542.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromoquinoline (CAS 3964-04-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 4-bromoquinoline. InChIKey: SUXIPCHEUMEUSV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 4-bromoquinoline |
| InChIKey | SUXIPCHEUMEUSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)Br |
Computed by PubChem (NCBI)