cas: 3964-04-3 — see every product listed under this CAS number, including other names
4-Bromoquinoline, 98% (CAS 3964-04-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048863-1G |
| cas | 3964-04-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 294.71 Pln | |
| Fluorochem | 100g | 1018.41 Pln | |
| Fluorochem | 500g | 4871.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-bromoquinoline (CAS 3964-04-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 4-bromoquinoline. InChIKey: SUXIPCHEUMEUSV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 4-bromoquinoline |
| InChIKey | SUXIPCHEUMEUSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)Br |
Computed by PubChem (NCBI)