cas: 90555-52-5 — see every product listed under this CAS number, including other names
4-CHLORO-3-METHYLPHENYL METHANESULFONATE, 97%, 97% (CAS 90555-52-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IG7V-250mg |
| cas | 90555-52-5 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 107.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-chloro-3-methylphenyl) methanesulfonate (CAS 90555-52-5) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: (4-chloro-3-methylphenyl) methanesulfonate. InChIKey: MLGDKWFNPBAIPM-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | (4-chloro-3-methylphenyl) methanesulfonate |
| InChIKey | MLGDKWFNPBAIPM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OS(=O)(=O)C)Cl |
Computed by PubChem (NCBI)