CAS 285991-71-1 appears in our catalog under these names: 4–Chloro–1,1–dimethylfuro(3,4–c)pyridin–3(1H)–one, 4-Chloro-1,1-dimethylfuro(3,4-c)pyridin-3(1H)-one, 4-Chloro-1,1-dimethylfuro[3,4-c]pyridin-3(1H)-one, 97%. Offered by: GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
4-chloro-1,1-dimethylfuro[3,4-c]pyridin-3-one (CAS 285991-71-1) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 4-chloro-1,1-dimethylfuro[3,4-c]pyridin-3-one. InChIKey: SYUCKMHGOHWLJH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-chloro-1,1-dimethylfuro[3,4-c]pyridin-3-one |
| InChIKey | SYUCKMHGOHWLJH-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=NC=C2)Cl)C(=O)O1)C |
Computed by PubChem (NCBI)