CAS 37629-52-0 appears in our catalog under these names: 1-(4-Chlorophenyl)-2-nitropropene, 95%, 1-(4-Chlorophenyl)-2-nitropropene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg.
1-chloro-4-[(E)-2-nitroprop-1-enyl]benzene (CAS 37629-52-0) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 1-chloro-4-[(E)-2-nitroprop-1-enyl]benzene. InChIKey: ABSQKQKOEFDZTI-VOTSOKGWSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 1-chloro-4-[(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | ABSQKQKOEFDZTI-VOTSOKGWSA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)Cl)/[N+](=O)[O-] |
Computed by PubChem (NCBI)