CAS 16331-48-9 appears in our catalog under these names: 4-Acetamidobenzoyl chloride, 96%, 4-ACETAMIDOBENZOYL CHLORIDE, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 200mg.
4-acetamidobenzoyl chloride (CAS 16331-48-9) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 4-acetamidobenzoyl chloride. InChIKey: KRKXGCJUNKZXOY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-acetamidobenzoyl chloride |
| InChIKey | KRKXGCJUNKZXOY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)