CAS 1506636-10-7 appears in our catalog under these names: 7-Chloro-2-methyl-2,4-dihydro-1,4-benzoxazin-3-one, 97%, 7-Chloro-2-Methyl-2H-benzo(b)(1,4)oxazin-3(4H)-one, 97%, 7-Chloro-2-methyl-2,4-dihydro-1,4-benzoxazin-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 25g, 5g, 2,5g.
7-chloro-2-methyl-4H-1,4-benzoxazin-3-one (CAS 1506636-10-7) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 7-chloro-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: UQOIDFOXHKZWQV-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 7-chloro-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | UQOIDFOXHKZWQV-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)