CAS 862695-75-8 appears in our catalog under these names: 6-Chloro-2-cyclopropylnicotinic acid, 95%, 6-Chloro-2-cyclopropylnicotinic acid, 95+%, 6–Chloro–2–cyclopropylnicotinic acid, 6-Chloro-2-cyclopropylnicotinic acid, 6-Chloro-2-cyclopropylnicotinic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 50mg, 500mg, 1000mg.
6-chloro-2-cyclopropylpyridine-3-carboxylic acid (CAS 862695-75-8) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 6-chloro-2-cyclopropylpyridine-3-carboxylic acid. InChIKey: FZPUPGGRIJXKTC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 6-chloro-2-cyclopropylpyridine-3-carboxylic acid |
| InChIKey | FZPUPGGRIJXKTC-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=CC(=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)