Products 1344408-15-6
CAS 1344408-15-6 appears in our catalog under these names: (2S)-5-chloro-2,3-dihydro-1h-indole-2-carboxylic acid, 95%, (2S)-5-chloroindoline-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2S)-5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid (CAS 1344408-15-6) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: (2S)-5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid. InChIKey: FXZZXHFPSBXQKT-QMMMGPOBSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (2S)-5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid |
| InChIKey | FXZZXHFPSBXQKT-QMMMGPOBSA-N |
| SMILES | C1[C@H](NC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)