CAS 1508393-11-0 is the registry number for 7-Chloro-4-methyl-2H-1,4-benzoxazin-3-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
7-chloro-4-methyl-1,4-benzoxazin-3-one (CAS 1508393-11-0) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 7-chloro-4-methyl-1,4-benzoxazin-3-one. InChIKey: MWJQKDMTYNAQDK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 7-chloro-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | MWJQKDMTYNAQDK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=CC(=C2)Cl |
Computed by PubChem (NCBI)