CAS 119413-61-5 is the registry number for 2-Chloro-3,4-dimethoxybenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-chloro-3,4-dimethoxybenzonitrile (CAS 119413-61-5) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 2-chloro-3,4-dimethoxybenzonitrile. InChIKey: DVVLTABTKVOGCS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 2-chloro-3,4-dimethoxybenzonitrile |
| InChIKey | DVVLTABTKVOGCS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C#N)Cl)OC |
Computed by PubChem (NCBI)