CAS 1353878-10-0 is the registry number for 7-Chloro-6-hydroxy-5-methyl-2,3-dihydro-1h-isoindol-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
7-chloro-6-hydroxy-5-methyl-2,3-dihydroisoindol-1-one (CAS 1353878-10-0) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 7-chloro-6-hydroxy-5-methyl-2,3-dihydroisoindol-1-one. InChIKey: QVDBWIVQDRJMDO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 7-chloro-6-hydroxy-5-methyl-2,3-dihydroisoindol-1-one |
| InChIKey | QVDBWIVQDRJMDO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)Cl)C(=O)NC2 |
Computed by PubChem (NCBI)