CAS 1138220-79-7 is the registry number for 5-Chloro-2,3-dihydro-6-methoxy-1h-isoindol-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-6-methoxy-2,3-dihydroisoindol-1-one (CAS 1138220-79-7) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 5-chloro-6-methoxy-2,3-dihydroisoindol-1-one. InChIKey: MMBRLXRMVPEDCW-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 5-chloro-6-methoxy-2,3-dihydroisoindol-1-one |
| InChIKey | MMBRLXRMVPEDCW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CNC(=O)C2=C1)Cl |
Computed by PubChem (NCBI)