cas: 88-49-3 — see every product listed under this CAS number, including other names
4-Chloro-2,5-dimethylbenzenesulfonyl chloride, 97% (CAS 88-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032485-1G |
| cas | 88-49-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 862.21 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2,5-dimethylbenzenesulfonyl chloride (CAS 88-49-3) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: 4-chloro-2,5-dimethylbenzenesulfonyl chloride. InChIKey: JBYZPUBAISWVDI-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 4-chloro-2,5-dimethylbenzenesulfonyl chloride |
| InChIKey | JBYZPUBAISWVDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)