cas: 1132-17-8 — see every product listed under this CAS number, including other names
4-Ethoxy-benzenesulfonyl chloride, 95% (CAS 1132-17-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F025194-1G |
| cas | 1132-17-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 909.07 Pln | |
| Fluorochem | 25g | 1882.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-ethoxybenzenesulfonyl chloride (CAS 1132-17-8) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 4-ethoxybenzenesulfonyl chloride. InChIKey: XIWSSFMVSKKXRJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 4-ethoxybenzenesulfonyl chloride |
| InChIKey | XIWSSFMVSKKXRJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)