cas: 367-86-2 — see every product listed under this CAS number, including other names
4-Fluoro-3-Nitrobenzotrifluoride 98% (CAS 367-86-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277073-5g |
| cas | 367-86-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 131.19 Pln | |
| Ambeed | 100g | 209.06 Pln | |
| Ambeed | 500g | 704.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277073 |
1-fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-4-(trifluoromethyl)benzene. InChIKey: HLDFCCHSOZWKAA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | HLDFCCHSOZWKAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)